EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO3 |
| Net Charge | 0 |
| Average Mass | 358.444 |
| Monoisotopic Mass | 358.19221 |
| SMILES | CNc1ccc(/C=C/c2ccc(OCCOCCOCC[18F])cc2)cc1 |
| InChI | InChI=1S/C21H26FNO3/c1-23-20-8-4-18(5-9-20)2-3-19-6-10-21(11-7-19)26-17-16-25-15-14-24-13-12-22/h2-11,23H,12-17H2,1H3/b3-2+/i22-1 |
| InChIKey | NCWZOASIUQVOFA-FWZJPQCDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. radiopharmaceutical Any pharmaceutical compound containing a radioisotope. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florbetaben (18F) (CHEBI:79033) has role antiparkinson drug (CHEBI:48407) |
| florbetaben (18F) (CHEBI:79033) has role radioactive imaging agent (CHEBI:37336) |
| florbetaben (18F) (CHEBI:79033) is a 18F radiopharmaceutical (CHEBI:49127) |
| florbetaben (18F) (CHEBI:79033) is a aromatic ether (CHEBI:35618) |
| florbetaben (18F) (CHEBI:79033) is a polyether (CHEBI:46774) |
| florbetaben (18F) (CHEBI:79033) is a secondary amino compound (CHEBI:50995) |
| florbetaben (18F) (CHEBI:79033) is a stilbenoid (CHEBI:26776) |
| florbetaben (18F) (CHEBI:79033) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-{(E)-2-[4-(2-{2-[2-(18F)fluoroethoxy]ethoxy}ethoxy)phenyl]ethenyl}-N-methylaniline |
| INNs | Source |
|---|---|
| florbetabene (18f) | WHO MedNet |
| florbetaben (18F) | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 18F-BAY94-9172 | ChemIDplus |
| 18F-Florbetaben | ChemIDplus |
| BAY 94-9172 | ChemIDplus |
| BAY94-9172 | ChemIDplus |
| florbetaben f18 | ChEMBL |
| Florbetaben f18 | ChEMBL |
| Brand Name | Source |
|---|---|
| Neuraceq | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4818 | DrugCentral |
| D10002 | KEGG DRUG |
| Florbetaben_F18 | Wikipedia |
| US2008025396 | Patent |
| US2008253967 | Patent |
| WO2010000409 | Patent |
| WO2013057199 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11713248 | Reaxys |
| CAS:902143-01-5 | ChemIDplus |
| CAS:902143-01-5 | KEGG DRUG |
| Citations |
|---|