EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N6O3S |
| Net Charge | 0 |
| Average Mass | 340.409 |
| Monoisotopic Mass | 340.13176 |
| SMILES | NCCCSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H20N6O3S/c14-2-1-3-23-4-7-9(20)10(21)13(22-7)19-6-18-8-11(15)16-5-17-12(8)19/h5-7,9-10,13,20-21H,1-4,14H2,(H2,15,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | FUSRAALGPJJIRO-QYVSTXNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ariopsis felis (ncbitaxon:75286) | - | PubMed (942371) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-adenosyl-3-thiopropylamine (CHEBI:79030) is a organic sulfide (CHEBI:16385) |
| S-adenosyl-3-thiopropylamine (CHEBI:79030) is a primary amino compound (CHEBI:50994) |
| S-adenosyl-3-thiopropylamine (CHEBI:79030) is a thioadenosine (CHEBI:26953) |
| IUPAC Name |
|---|
| 5'-S-(3-aminopropyl)-5'-thioadenosine |
| Manual Xrefs | Databases |
|---|---|
| DSH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:577457 | Reaxys |
| CAS:53186-57-5 | ChemIDplus |
| Citations |
|---|