EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H11NO7P2 |
| Net Charge | 0 |
| Average Mass | 235.069 |
| Monoisotopic Mass | 235.00107 |
| SMILES | NCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H11NO7P2/c4-2-1-3(5,12(6,7)8)13(9,10)11/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | WRUUGTRCQOWXEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pamidronate (CHEBI:7903) is a phosphonoacetic acid (CHEBI:15732) |
| Synonyms | Source |
|---|---|
| (3-amino-1-hydroxypropane-1,1-diyl)bis(phosphonic acid) | PDBeChem |
| pamidronate | DrugCentral |
| Pamidronate | KEGG COMPOUND |
| PAMIDRONATE | PDBeChem |
| pamidronate disodium | DrugCentral |
| pamidronate disodium hydrate | DrugCentral |