EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45O2 |
| Net Charge | -1 |
| Average Mass | 353.611 |
| Monoisotopic Mass | 353.34250 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-22H2,1H3,(H,24,25)/p-1 |
| InChIKey | XEZVDURJDFGERA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricosanoate (CHEBI:79007) is a fatty acid anion 23:0 (CHEBI:88081) |
| tricosanoate (CHEBI:79007) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| tricosanoate (CHEBI:79007) is a very long-chain fatty acid anion (CHEBI:58950) |
| tricosanoate (CHEBI:79007) is conjugate base of tricosanoic acid (CHEBI:42394) |
| Incoming Relation(s) |
| N-tricosanoyltaurine(1−) (CHEBI:146197) has functional parent tricosanoate (CHEBI:79007) |
| 2-hydroxytricosanoate (CHEBI:84316) has functional parent tricosanoate (CHEBI:79007) |
| tricosanoic acid (CHEBI:42394) is conjugate acid of tricosanoate (CHEBI:79007) |
| IUPAC Name |
|---|
| tricosanoate |
| UniProt Name | Source |
|---|---|
| tricosanoate | UniProt |
| Citations |
|---|