EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O3 |
| Net Charge | 0 |
| Average Mass | 258.402 |
| Monoisotopic Mass | 258.21949 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O3/c1-14(16)12-10-8-6-4-2-3-5-7-9-11-13-15(17)18/h14,16H,2-13H2,1H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | ZKOKHYPUQUATDA-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (14R)-14-hydroxypentadecanoic acid (CHEBI:78996) has functional parent pentadecanoic acid (CHEBI:42504) |
| (14R)-14-hydroxypentadecanoic acid (CHEBI:78996) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (14R)-14-hydroxypentadecanoic acid (CHEBI:78996) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| (3R,14R)-3,14-dihydroxypentadecanoic acid (CHEBI:79247) has functional parent (14R)-14-hydroxypentadecanoic acid (CHEBI:78996) |
| ascr#26 (CHEBI:78964) has functional parent (14R)-14-hydroxypentadecanoic acid (CHEBI:78996) |
| IUPAC Name |
|---|
| (14R)-14-hydroxypentadecanoic acid |
| Synonyms | Source |
|---|---|
| (−)-14-hydroxypentadecanoic acid | ChEBI |
| (14R)-(−)-14-hydroxypentadecanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6501675 | Reaxys |