EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48O6 |
| Net Charge | 0 |
| Average Mass | 444.653 |
| Monoisotopic Mass | 444.34509 |
| SMILES | C[C@H](CCCCCCCCCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H48O6/c1-20(30-25-23(27)19-22(26)21(2)31-25)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-24(28)29/h20-23,25-27H,3-19H2,1-2H3,(H,28,29)/t20-,21+,22-,23-,25-/m1/s1 |
| InChIKey | CGDGMTQYHSCWOZ-FYEJASGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. Ascr#34 is a major ascaroside in daf-22(ok693) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#34 (CHEBI:78972) has functional parent (18R)-18-hydroxynonadecanoic acid (CHEBI:79011) |
| ascr#34 (CHEBI:78972) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#34 (CHEBI:78972) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#34 (CHEBI:78972) is a monocarboxylic acid (CHEBI:25384) |
| ascr#34 (CHEBI:78972) is conjugate acid of ascr#34(1-) (CHEBI:139690) |
| Incoming Relation(s) |
| bhas#34 (CHEBI:79237) has functional parent ascr#34 (CHEBI:78972) |
| ascr#34(1-) (CHEBI:139690) is conjugate base of ascr#34 (CHEBI:78972) |
| IUPAC Name |
|---|
| (18R)-18-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonadecanoic acid |
| Synonym | Source |
|---|---|
| 18R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2334%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233490 | Reaxys |
| CAS:1355681-83-2 | SMID |
| Citations |
|---|