EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O3 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 160.10994 |
| SMILES | C[C@@H](O)CCCCCC(=O)O |
| InChI | InChI=1S/C8H16O3/c1-7(9)5-3-2-4-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | OFCMTSZRXXFMBQ-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7R)-7-hydroxyoctanoic acid (CHEBI:78949) has functional parent octanoic acid (CHEBI:28837) |
| (7R)-7-hydroxyoctanoic acid (CHEBI:78949) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (7R)-7-hydroxyoctanoic acid (CHEBI:78949) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| ascr#14 (CHEBI:78905) has functional parent (7R)-7-hydroxyoctanoic acid (CHEBI:78949) |
| icas#14 (CHEBI:79061) has functional parent (7R)-7-hydroxyoctanoic acid (CHEBI:78949) |
| IUPAC Name |
|---|
| (7R)-7-hydroxyoctanoic acid |
| Synonyms | Source |
|---|---|
| (−)-7-hydroxycaprylic acid | ChEBI |
| (−)-7-hydroxyoctanoic acid | ChEBI |
| (7R)-(−)-7-hydroxycaprylic acid | ChEBI |
| (7R)-7-hydroxycaprylic acid | ChEBI |
| (7R)-(−)-7-hydroxyoctanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4657197 | Reaxys |