EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C4H6O2)m.(C6H9NO)n |
| Net Charge | 0 |
| Average Mass | 197.234 |
| Monoisotopic Mass | 197.10519 |
| SMILES | C=CN1CCCC1=O.C=COC(C)=O |
| InChI | InChI=1S/C6H9NO.C4H6O2/c1-2-7-5-3-4-6(7)8;1-3-6-4(2)5/h2H,1,3-5H2;3H,1H2,2H3 |
| InChIKey | FYUWIEKAVLOHSE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| copovidone macromolecule (CHEBI:78910) is a copolymer macromolecule (CHEBI:53310) |
| Incoming Relation(s) |
| functionalised copovidone group (CHEBI:78922) has functional parent copovidone macromolecule (CHEBI:78910) |
| β-D-arabinosyl-(1→2)-α-D-arabinosyl-(1→3)-[β-D-arabinosyl-(1→2)-α-D-arabinosyl-(1→5)]-α-Darabinosyl-(1→5)-α-D-arabinoside—copovidone glycoconjugate (CHEBI:78916) has functional parent copovidone macromolecule (CHEBI:78910) |
| β-D-mannosyl-(1→2)-β-D-mannosyl-(1→2)-α-D-mannoside—copovidone glycoconjugate (CHEBI:78898) has functional parent copovidone macromolecule (CHEBI:78910) |
| β-D-mannosyl-(1→2)-β-D-mannosyl-(1→2)-β-D-mannoside—copovidone glycoconjugate (CHEBI:78914) has functional parent copovidone macromolecule (CHEBI:78910) |
| copovidone (CHEBI:78913) has part copovidone macromolecule (CHEBI:78910) |
| Synonyms | Source |
|---|---|
| 1-Ethenyl-2-pyrrolidinone, polymer with acetic acid ethenyl ester | ChemIDplus |
| 1-Ethenyl-2-pyrrolidinone, polymer with ethenyl acetate | ChemIDplus |
| 1-Vinyl-2-pyrrolidone-vinyl acetate copolymer | ChemIDplus |
| Acetic acid vinyl ester, polymer with 1-vinyl-2-pyrrolidinone | ChemIDplus |
| Poly(vinylpyrrolidone-co-vinyl-acetate) | ChemIDplus |
| PVP/VA Copolymer | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11313046 | Reaxys |
| CAS:25086-89-9 | ChemIDplus |