EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O4 |
| Net Charge | 0 |
| Average Mass | 310.434 |
| Monoisotopic Mass | 310.21441 |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\CCCCC(=O)O)OO |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-8-11-14-17(22-21)15-12-9-6-7-10-13-16-18(19)20/h6,8-9,11-12,15,17,21H,2-5,7,10,13-14,16H2,1H3,(H,19,20)/b9-6-,11-8-,15-12+/t17-/m1/s1 |
| InChIKey | NBHLHVQEXIPLAI-NHRFXGAXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10(R)-HPO(6,8,12)TrE (CHEBI:78908) has functional parent γ-linolenic acid (CHEBI:28661) |
| 10(R)-HPO(6,8,12)TrE (CHEBI:78908) is a 10-HPO(6,8,12)TrE (CHEBI:84180) |
| 10(R)-HPO(6,8,12)TrE (CHEBI:78908) is conjugate acid of 10(R)-HPO(6,8,12)TrE(1−) (CHEBI:78070) |
| Incoming Relation(s) |
| 10(R)-HPO(6,8,12)TrE(1−) (CHEBI:78070) is conjugate base of 10(R)-HPO(6,8,12)TrE (CHEBI:78908) |
| IUPAC Name |
|---|
| (6Z,8E,10R,12Z)-10-hydroperoxyoctadeca-6,8,12-trienoic acid |
| Synonym | Source |
|---|---|
| (6Z,8E,10R,12Z)-hydroperoxyoctadecatrienoic acid | ChEBI |