EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N4O3.H2O4S |
| Net Charge | 0 |
| Average Mass | 274.255 |
| Monoisotopic Mass | 274.05832 |
| SMILES | N=C(N)NOCC[C@H](N)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C5H12N4O3.H2O4S/c6-3(4(10)11)1-2-12-9-5(7)8;1-5(2,3)4/h3H,1-2,6H2,(H,10,11)(H4,7,8,9);(H2,1,2,3,4)/t3-;/m0./s1 |
| InChIKey | MVIPJKVMOKFIEV-DFWYDOINSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-canavanine sulfate (CHEBI:78901) has part L-canavanine(1+) (CHEBI:78902) |
| L-canavanine sulfate (CHEBI:78901) has role plant metabolite (CHEBI:76924) |
| L-canavanine sulfate (CHEBI:78901) is a organic sulfate salt (CHEBI:51337) |
| IUPAC Names |
|---|
| (2S)-2-azaniumyl-4-({[ammonio(imino)methyl]amino}oxy)butanoate hydrogen sulfate |
| O-carbamimidamido-L-homoserine sulfate |
| Synonyms | Source |
|---|---|
| (+)-canavanine monosulfate | ChEBI |
| canavanine monosulfate | ChEBI |
| (+)-canavanine sulfate | ChEBI |
| Canavanine sulfate | ChemIDplus |
| Canavanine sulphate | ChemIDplus |
| L-canavanine monosulfate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6121291 | Reaxys |
| CAS:2219-31-0 | ChemIDplus |
| Citations |
|---|