EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1=CCC(O)(C(C)C)CC1 |
| InChI | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
| InChIKey | WRYLYDPHFGVWKC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | PubMed (16418522) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiparasitic agent A substance used to treat or prevent parasitic infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-terpineol (CHEBI:78884) has role anti-inflammatory agent (CHEBI:67079) |
| 4-terpineol (CHEBI:78884) has role antibacterial agent (CHEBI:33282) |
| 4-terpineol (CHEBI:78884) has role antineoplastic agent (CHEBI:35610) |
| 4-terpineol (CHEBI:78884) has role antioxidant (CHEBI:22586) |
| 4-terpineol (CHEBI:78884) has role antiparasitic agent (CHEBI:35442) |
| 4-terpineol (CHEBI:78884) has role apoptosis inducer (CHEBI:68495) |
| 4-terpineol (CHEBI:78884) has role plant metabolite (CHEBI:76924) |
| 4-terpineol (CHEBI:78884) has role volatile oil component (CHEBI:27311) |
| 4-terpineol (CHEBI:78884) is a terpineol (CHEBI:26876) |
| 4-terpineol (CHEBI:78884) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| tea tree oil (CHEBI:83629) has part 4-terpineol (CHEBI:78884) |
| IUPAC Name |
|---|
| 4-methyl-1-(propan-2-yl)cyclohex-3-en-1-ol |
| Synonyms | Source |
|---|---|
| 1-isopropyl-4-methylcyclohex-3-en-1-ol | IUPAC |
| 1-Menthene-4-ol | ChemIDplus |
| 1-Methyl-4-isopropyl-1-cyclohexen-4-ol | ChemIDplus |
| 1-Methyl-4-isopropyl-1-cyclohexen-4-ol | HMDB |
| 1-para-Menthen-4-ol | ChemIDplus |
| 1-p-Menthen-4-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-terpineol | UniProt |
| Citations |
|---|