EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2ClN3O3 |
| Net Charge | 0 |
| Average Mass | 199.553 |
| Monoisotopic Mass | 198.97847 |
| SMILES | O=[N+]([O-])c1ccc(Cl)c2nonc12 |
| InChI | InChI=1S/C6H2ClN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H |
| InChIKey | IGHBXJSNZCFXNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). EC 3.6.1.3 (adenosinetriphosphatase) inhibitor An EC 3.6.1.* (hydrolases acting on acid anhydrides in P-containing anhydrides) inhibitor that interferes with the action of adenosinetriphosphatase (EC 3.6.1.3). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) has role EC 3.6.1.3 (adenosinetriphosphatase) inhibitor (CHEBI:78928) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) has role fluorescent probe (CHEBI:39442) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) has role fluorochrome (CHEBI:51217) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) is a C-nitro compound (CHEBI:35716) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) is a benzoxadiazole (CHEBI:46829) |
| 4-chloro-7-nitrobenzofurazan (CHEBI:78878) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 4-chloro-7-nitro-2,1,3-benzoxadiazole |
| Synonyms | Source |
|---|---|
| 1-chloro-4-nitrobenzoxadiazole | ChemIDplus |
| 4-chloro-7-nitrobenzo-2-oxa-1,3-diazole | ChemIDplus |
| 4-chloro-7-nitrobenzofurazan | ChemIDplus |
| 4-nitro-7-chlorobenzofurazan | ChemIDplus |
| 7-chloro-4-nitrobenzo-2-oxa-1,3-diazole | ChemIDplus |
| 7-chloro-4-nitrobenzofurazan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:614212 | Reaxys |
| CAS:10199-89-0 | ChemIDplus |
| Citations |
|---|