EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\CCC(=O)O)OO |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-12-15-18-21(26-25)19-16-13-10-8-6-7-9-11-14-17-20-22(23)24/h3-4,6-7,10-16,19,21,25H,2,5,8-9,17-18,20H2,1H3,(H,23,24)/b4-3-,7-6-,13-10-,14-11-,15-12-,19-16+/t21-/m0/s1 |
| InChIKey | OAGAUECBCOAGOL-OUKOMXQNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14(S)-HPDHE (CHEBI:78861) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| 14(S)-HPDHE (CHEBI:78861) is a 14-HPDHE (CHEBI:84177) |
| 14(S)-HPDHE (CHEBI:78861) is conjugate acid of 14(S)-HPDHE(1−) (CHEBI:78048) |
| Incoming Relation(s) |
| 14(S)-HPDHE(1−) (CHEBI:78048) is conjugate base of 14(S)-HPDHE (CHEBI:78861) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,12E,14S,16Z,19Z)-14-hydroperoxydocosa-4,7,10,12,16,19-hexaenoic acid |
| Synonym | Source |
|---|---|
| (4Z,7Z,10Z,12E,14S,16Z,19Z)-hydroperoxydocosahexaenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20137088 | Reaxys |