EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | CCCCC/C=C\C[C@@H](/C=C/C=C\CCCCCCC(=O)O)OO |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h8,10-11,13-14,17,19,23H,2-7,9,12,15-16,18H2,1H3,(H,21,22)/b11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | CZOASFIZEHMKCK-ONNNWOQGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HPE(8,10,14)TrE (CHEBI:78860) has functional parent all-cis-icosa-8,11,14-trienoic acid (CHEBI:53486) |
| 12(S)-HPE(8,10,14)TrE (CHEBI:78860) is a 12-HPE(8,10,14)TrE (CHEBI:84174) |
| 12(S)-HPE(8,10,14)TrE (CHEBI:78860) is conjugate acid of 12(S)-HPE(8,10,14)TrE(1−) (CHEBI:78047) |
| Incoming Relation(s) |
| 12(S)-HPE(8,10,14)TrE(1−) (CHEBI:78047) is conjugate base of 12(S)-HPE(8,10,14)TrE (CHEBI:78860) |
| IUPAC Name |
|---|
| (8Z,10E,12S,14Z)-12-hydroperoxyicosa-8,10,14-trienoic acid |
| Synonyms | Source |
|---|---|
| (8Z,10E,12S,14Z)-hydroperoxyeicosatrienoic acid | ChEBI |
| (8Z,10E,12S,14Z)-hydroperoxyicosatrienoic acid | ChEBI |