EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17FN2O |
| Net Charge | 0 |
| Average Mass | 296.345 |
| Monoisotopic Mass | 296.13249 |
| SMILES | Cc1nc2ccccc2c1CCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H17FN2O/c1-12-13(14-6-3-5-9-17(14)21-12)10-11-20-18(22)15-7-2-4-8-16(15)19/h2-9,21H,10-11H2,1H3,(H,20,22) |
| InChIKey | UXRKUKRXVWJFER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CK-666 (CHEBI:78843) has role actin polymerisation inhibitor (CHEBI:70728) |
| CK-666 (CHEBI:78843) is a benzamides (CHEBI:22702) |
| CK-666 (CHEBI:78843) is a indoles (CHEBI:24828) |
| CK-666 (CHEBI:78843) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2-fluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide |
| Synonyms | Source |
|---|---|
| CK666 | ChEBI |
| CK 666 | ChEBI |
| CK-0944666 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CKH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19720234 | Reaxys |
| Citations |
|---|