EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18FN5O5S |
| Net Charge | 0 |
| Average Mass | 471.470 |
| Monoisotopic Mass | 471.10127 |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2c(C)c3ccc(Oc4ncccn4)cc3oc2=O)c1F |
| InChI | InChI=1S/C21H18FN5O5S/c1-12-15-5-4-14(31-21-25-7-3-8-26-21)11-17(15)32-20(28)16(12)10-13-6-9-24-19(18(13)22)27-33(29,30)23-2/h3-9,11,23H,10H2,1-2H3,(H,24,27) |
| InChIKey | LMMJFBMMJUMSJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CH5126766 (CHEBI:78825) has role antineoplastic agent (CHEBI:35610) |
| CH5126766 (CHEBI:78825) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| CH5126766 (CHEBI:78825) is a aryloxypyrimidine (CHEBI:48535) |
| CH5126766 (CHEBI:78825) is a coumarins (CHEBI:23403) |
| CH5126766 (CHEBI:78825) is a organofluorine compound (CHEBI:37143) |
| CH5126766 (CHEBI:78825) is a pyridines (CHEBI:26421) |
| CH5126766 (CHEBI:78825) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| 3-[[2-[(methylaminosulfonyl)amino]-3-fluoropyridin-4-yl]methyl]-4-methyl-7-[(pyrimidin-2-yl)oxy]-2H-1-benzopyran-2-one |
| Synonym | Source |
|---|---|
| RO5126766 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18297991 | Reaxys |
| Citations |
|---|