EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41O2 |
| Net Charge | -1 |
| Average Mass | 325.557 |
| Monoisotopic Mass | 325.31120 |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C21H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-20H2,1H3,(H,22,23)/p-1 |
| InChIKey | CKDDRHZIAZRDBW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| henicosanoate (CHEBI:78797) is a fatty acid anion 21:0 (CHEBI:78893) |
| henicosanoate (CHEBI:78797) is a long-chain fatty acid anion (CHEBI:57560) |
| henicosanoate (CHEBI:78797) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| henicosanoate (CHEBI:78797) is conjugate base of henicosanoic acid (CHEBI:39248) |
| Incoming Relation(s) |
| 20-hydroxyhenicosanoate (CHEBI:140697) has functional parent henicosanoate (CHEBI:78797) |
| henicosanoic acid (CHEBI:39248) is conjugate acid of henicosanoate (CHEBI:78797) |
| IUPAC Name |
|---|
| henicosanoate |
| UniProt Name | Source |
|---|---|
| heneicosanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3670885 | Reaxys |