EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29O2 |
| Net Charge | -1 |
| Average Mass | 241.395 |
| Monoisotopic Mass | 241.21730 |
| SMILES | CCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)/p-1 |
| InChIKey | WQEPLUUGTLDZJY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentadecanoate (CHEBI:78795) has role animal metabolite (CHEBI:75767) |
| pentadecanoate (CHEBI:78795) has role plant metabolite (CHEBI:76924) |
| pentadecanoate (CHEBI:78795) is a fatty acid anion 15:0 (CHEBI:78122) |
| pentadecanoate (CHEBI:78795) is a long-chain fatty acid anion (CHEBI:57560) |
| pentadecanoate (CHEBI:78795) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| pentadecanoate (CHEBI:78795) is conjugate base of pentadecanoic acid (CHEBI:42504) |
| Incoming Relation(s) |
| pentadecanoic acid (CHEBI:42504) is conjugate acid of pentadecanoate (CHEBI:78795) |
| UniProt Name | Source |
|---|---|
| pentadecanoate | UniProt |