EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78780 - pyraclostrobin
| Formula | C19H18ClN3O4 |
| Net Charge | 0 |
| Average Mass | 387.823 |
| Monoisotopic Mass | 387.09858 |
| SMILES | COC(=O)N(OC)c1ccccc1COc1ccn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-25-19(24)23(26-2)17-6-4-3-5-14(17)13-27-18-11-12-22(21-18)16-9-7-15(20)8-10-16/h3-12H,13H2,1-2H3 |
| InChIKey | HZRSNVGNWUDEFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyraclostrobin (CHEBI:78780) has role antifungal agrochemical (CHEBI:86328) |
| pyraclostrobin (CHEBI:78780) has role environmental contaminant (CHEBI:78298) |
| pyraclostrobin (CHEBI:78780) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| pyraclostrobin (CHEBI:78780) has role xenobiotic (CHEBI:35703) |
| pyraclostrobin (CHEBI:78780) is a aromatic ether (CHEBI:35618) |
| pyraclostrobin (CHEBI:78780) is a carbamate ester (CHEBI:23003) |
| pyraclostrobin (CHEBI:78780) is a carbanilate fungicide (CHEBI:87066) |
| pyraclostrobin (CHEBI:78780) is a methoxycarbanilate strobilurin antifungal agent (CHEBI:86485) |
| pyraclostrobin (CHEBI:78780) is a monochlorobenzenes (CHEBI:83403) |
| pyraclostrobin (CHEBI:78780) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| methyl [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamate |
| Synonym | Source |
|---|---|
| Pyraclostrobine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C18561 | KEGG COMPOUND |
| pyraclostrobin | Alan Wood's Pesticides |
| 564 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10095527 | Reaxys |
| CAS:175013-18-0 | KEGG COMPOUND |
| CAS:175013-18-0 | ChemIDplus |
| CAS:175013-18-0 | NIST Chemistry WebBook |
| Citations |
|---|