EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H23ClN2O4 |
| Net Charge | 0 |
| Average Mass | 534.999 |
| Monoisotopic Mass | 534.13463 |
| SMILES | N#Cc1c(-c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)cc(-c2cc(Cl)ccc2O)nc1=O |
| InChI | InChI=1S/C32H23ClN2O4/c33-24-11-12-31(36)28(15-24)30-17-27(29(18-34)32(37)35-30)23-13-25(38-19-21-7-3-1-4-8-21)16-26(14-23)39-20-22-9-5-2-6-10-22/h1-17,36H,19-20H2,(H,35,37) |
| InChIKey | NZRBRJQYGLEINZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). survivin dimerisation modulator Any compound that affects the dimerisation of the protein survivin. inhibitor A substance that diminishes the rate of a chemical reaction. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LLP-3 (CHEBI:78766) has role antimitotic (CHEBI:64911) |
| LLP-3 (CHEBI:78766) has role antineoplastic agent (CHEBI:35610) |
| LLP-3 (CHEBI:78766) has role inhibitor (CHEBI:35222) |
| LLP-3 (CHEBI:78766) has role survivin dimerisation modulator (CHEBI:78926) |
| LLP-3 (CHEBI:78766) is a aromatic ether (CHEBI:35618) |
| LLP-3 (CHEBI:78766) is a benzyl ether (CHEBI:59859) |
| LLP-3 (CHEBI:78766) is a hydroxynitrile (CHEBI:24730) |
| LLP-3 (CHEBI:78766) is a monochlorobenzenes (CHEBI:83403) |
| LLP-3 (CHEBI:78766) is a phenols (CHEBI:33853) |
| LLP-3 (CHEBI:78766) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 4-[3,5-bis(benzyloxy)phenyl]-6-(5-chloro-2-hydroxyphenyl)-2-oxo-1,2-dihydropyridine-3-carbonitrile |
| Synonym | Source |
|---|---|
| LLP3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23916493 | Reaxys |
| Citations |
|---|