EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H41NO2 |
| Net Charge | 0 |
| Average Mass | 327.553 |
| Monoisotopic Mass | 327.31373 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)N(C)C |
| InChI | InChI=1S/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/b17-16+/t19-,20+/m0/s1 |
| InChIKey | YRXOQXUDKDCXME-YIVRLKKSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.91 (sphingosine kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of sphinganine kinase (EC 2.7.1.91). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylsphingosine (CHEBI:78759) has functional parent sphingosine (CHEBI:16393) |
| N,N-dimethylsphingosine (CHEBI:78759) has role EC 2.7.1.91 (sphingosine kinase) inhibitor (CHEBI:78760) |
| N,N-dimethylsphingosine (CHEBI:78759) has role metabolite (CHEBI:25212) |
| N,N-dimethylsphingosine (CHEBI:78759) is a aminodiol (CHEBI:22501) |
| N,N-dimethylsphingosine (CHEBI:78759) is a sphingoid (CHEBI:35785) |
| N,N-dimethylsphingosine (CHEBI:78759) is a tertiary amino compound (CHEBI:50996) |
| N,N-dimethylsphingosine (CHEBI:78759) is conjugate base of N,N-dimethylsphingosine(1+) (CHEBI:189587) |
| Incoming Relation(s) |
| N,N-dimethylsphingosine(1+) (CHEBI:189587) is conjugate acid of N,N-dimethylsphingosine (CHEBI:78759) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-(dimethylamino)octadec-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| N,N-dimethylsphing-4-enine | ChEBI |
| N,N-Dimethyl-D-erythro-sphingosine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C13914 | KEGG COMPOUND |
| HMDB0013645 | HMDB |
| LMSP01070001 | LIPID MAPS |
| N,N-Dimethylsphingosine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8057448 | Reaxys |
| CAS:122314-67-4 | ChemIDplus |