EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H41NO2 |
| Net Charge | 0 |
| Average Mass | 327.553 |
| Monoisotopic Mass | 327.31373 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)N(C)C |
| InChI | InChI=1S/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/b17-16+/t19-,20+/m0/s1 |
| InChIKey | YRXOQXUDKDCXME-YIVRLKKSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.7.1.91 (sphingosine kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of sphinganine kinase (EC 2.7.1.91). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylsphingosine (CHEBI:78759) has functional parent sphingosine (CHEBI:16393) |
| N,N-dimethylsphingosine (CHEBI:78759) has role EC 2.7.1.91 (sphingosine kinase) inhibitor (CHEBI:78760) |
| N,N-dimethylsphingosine (CHEBI:78759) has role metabolite (CHEBI:25212) |
| N,N-dimethylsphingosine (CHEBI:78759) is a aminodiol (CHEBI:22501) |
| N,N-dimethylsphingosine (CHEBI:78759) is a sphingoid (CHEBI:35785) |
| N,N-dimethylsphingosine (CHEBI:78759) is a tertiary amino compound (CHEBI:50996) |
| N,N-dimethylsphingosine (CHEBI:78759) is conjugate base of N,N-dimethylsphingosine(1+) (CHEBI:189587) |
| Incoming Relation(s) |
| N,N-dimethylsphingosine(1+) (CHEBI:189587) is conjugate acid of N,N-dimethylsphingosine (CHEBI:78759) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-(dimethylamino)octadec-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| N,N-dimethylsphing-4-enine | ChEBI |
| N,N-Dimethyl-D-erythro-sphingosine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013645 | HMDB |
| LMSP01070001 | LIPID MAPS |
| N,N-Dimethylsphingosine | Wikipedia |
| C13914 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8057448 | Reaxys |
| CAS:122314-67-4 | ChemIDplus |