EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H90N6O14 |
| Net Charge | 0 |
| Average Mass | 1119.408 |
| Monoisotopic Mass | 1118.65150 |
| SMILES | CC(C)C[C@H]1C(=O)O[C@H](Cc2ccc(N3CCOCC3)cc2)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](Cc2ccc(N3CCOCC3)cc2)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C60H90N6O14/c1-37(2)31-47-57(71)77-41(9)53(67)61(11)50(34-40(7)8)60(74)80-52(36-44-17-21-46(22-18-44)66-25-29-76-30-26-66)56(70)64(14)48(32-38(3)4)58(72)78-42(10)54(68)62(12)49(33-39(5)6)59(73)79-51(55(69)63(47)13)35-43-15-19-45(20-16-43)65-23-27-75-28-24-65/h15-22,37-42,47-52H,23-36H2,1-14H3/t41-,42-,47+,48+,49+,50+,51-,52-/m1/s1 |
| InChIKey | ZMQMTKVVAMWKNY-YSXLEBCMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). antinematodal drug A substance used in the treatment or control of nematode infestations. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emodepside (CHEBI:78739) has role anthelminthic drug (CHEBI:35443) |
| emodepside (CHEBI:78739) has role antinematodal drug (CHEBI:35444) |
| emodepside (CHEBI:78739) is a cyclooctadepsipeptide (CHEBI:78740) |
| emodepside (CHEBI:78739) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R,21S,24R)-3,9,15,21-tetraisobutyl-4,6,10,16,18,22-hexamethyl-12,24-bis[4-(morpholin-4-yl)benzyl]-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
| INNs | Source |
|---|---|
| emodepsida | WHO MedNet |
| emodepside | WHO MedNet |
| émodepside | WHO MedNet |
| emodepsidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 44-4400 | ChEMBL |
| BAY-44-4400 | ChEMBL |
| cyclo[(R)-lactoyl-N-methyl-L-leucyl-(R)-3-(p-morpholinophenyl)lactoyl-N-methyl-L-leucyl-(R)-lactoyl-N-methyl-L-leucyl-(R)-3-(p-morpholinophenyl)lactoyl-N-methyl-L-leucyl] | ChemIDplus |
| cyclo [D-2-hydroxypropanoyl-N-methyl-L-leucyl-3-[4-(4-morpholinyl)phenyl]-D-2-hydroxypropanoyl-N-methyl-L-leucyl-D-2-hydroxypropanoyl-N-methyl-L-leucyl-3-[4-(4-morpholinyl)phenyl]-D-2-hydroxypropanoyl-N-methyl-L-leucyl] | ChEBI |
| cyclo {D-lactoyl-N-methyl-L-leucyl-3-[4-(4-morpholinyl)phenyl]-D-lactoyl-N-methyl-L-leucyl-D-lactoyl-N-methyl-L-leucyl-3-[4-(4-morpholinyl)phenyl]-D-lactoyl-N-methyl-L-leucyl} | ChEBI |
| PF 1022-221 | ChEMBL |
| Brand Names | Source |
|---|---|
| Emodepside component of procox | ChEMBL |
| Emodepside component of profender | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1838 | VSDB |
| C18390 | KEGG COMPOUND |
| Emodepside | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155030-63-0 | KEGG COMPOUND |
| CAS:155030-63-0 | ChemIDplus |
| Citations |
|---|