EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NS |
| Net Charge | 0 |
| Average Mass | 127.212 |
| Monoisotopic Mass | 127.04557 |
| SMILES | Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C6H9NS/c1-4-5(2)8-6(3)7-4/h1-3H3 |
| InChIKey | BAMPVSWRQZNDQC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,5-trimethylthiazole (CHEBI:78738) has role Maillard reaction product (CHEBI:77523) |
| 2,4,5-trimethylthiazole (CHEBI:78738) is a 1,3-thiazoles (CHEBI:38418) |
| IUPAC Name |
|---|
| 2,4,5-trimethyl-1,3-thiazole |
| Synonym | Source |
|---|---|
| trimethylthiazole | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033155 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:107148 | Reaxys |
| CAS:13623-11-5 | NIST Chemistry WebBook |
| CAS:13623-11-5 | ChemIDplus |
| Citations |
|---|