EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C26H43NO17)n.H2O |
| Net Charge | 0 |
| Average Mass | 659.635 |
| Monoisotopic Mass | 659.26366 |
| SMILES | [H]O[C@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](O)[C@H](C)O[C@@H](O[C@H]4[C@H](O)[C@@H](CO)O[C@@H](O)[C@@H]4NC(C)=O)[C@@H]3O)O[C@@H](C)[C@H](O)[C@H]2O)O[C@@H](C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H45NO18/c1-6-12(30)16(34)18(36)24(39-6)45-22-17(35)13(31)7(2)41-26(22)44-21-14(32)8(3)40-25(19(21)37)43-20-11(27-9(4)29)23(38)42-10(5-28)15(20)33/h6-8,10-26,28,30-38H,5H2,1-4H3,(H,27,29)/t6-,7-,8-,10+,11+,12-,13-,14-,15+,16+,17+,18+,19+,20+,21+,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | UTJMWWBYJZRONA-KZLWEHJKSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S. flexneri serotype Y O-polysaccharide (O factor 9-negative) (CHEBI:78729) has role antigen (CHEBI:59132) |
| S. flexneri serotype Y O-polysaccharide (O factor 9-negative) (CHEBI:78729) is a polysaccharide derivative (CHEBI:65212) |
| Synonyms | Source |
|---|---|
| [2)-α-L-RhapIII-(1→2)-α-L-RhapII-(1→3)-α-L-RhapI-(1→3)-β-D-GlcpNAc-(1→]n | ChEBI |
| [2)-α-L-RhaIII-(1→2)-α-L-RhaII-(1→3)-α-L-RhaI-(1→3)-β-D-GlcNAc-(1→]n | ChEBI |
| Citations |
|---|