EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H47N |
| Net Charge | 0 |
| Average Mass | 373.669 |
| Monoisotopic Mass | 373.37085 |
| SMILES | [H][C@@]12CCCC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCN(C)C)[C@]1([H])CC2 |
| InChI | InChI=1S/C26H47N/c1-19(9-8-18-27(4)5)22-13-14-23-21-12-11-20-10-6-7-16-25(20,2)24(21)15-17-26(22,23)3/h19-24H,6-18H2,1-5H3/t19-,20+,21+,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | LJQDDVJEZIEHNY-FHNVJLOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-azacoprostane (CHEBI:78726) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| 25-azacoprostane (CHEBI:78726) is a aza-steroid (CHEBI:35726) |
| 25-azacoprostane (CHEBI:78726) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| (5β)-N,N-dimethylcholan-24-amine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3140801 | Reaxys |
| CAS:37106-88-0 | ChemIDplus |
| Citations |
|---|