EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N2O3.ClO4 |
| Net Charge | 0 |
| Average Mass | 514.962 |
| Monoisotopic Mass | 514.15068 |
| SMILES | CCOC(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2oc2cc(N(C)C)ccc12.O=Cl(=O)(=O)[O-] |
| InChI | InChI=1S/C26H27N2O3.ClHO4/c1-6-30-26(29)20-10-8-7-9-19(20)25-21-13-11-17(27(2)3)15-23(21)31-24-16-18(28(4)5)12-14-22(24)25;2-1(3,4)5/h7-16H,6H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NBAOBNBFGNQAEJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethylrhodamine ethyl ester perchlorate (CHEBI:78720) has part tetramethylrhodamine ethyl ester(1+) (CHEBI:78721) |
| tetramethylrhodamine ethyl ester perchlorate (CHEBI:78720) has role fluorochrome (CHEBI:51217) |
| tetramethylrhodamine ethyl ester perchlorate (CHEBI:78720) has role reagent (CHEBI:33893) |
| tetramethylrhodamine ethyl ester perchlorate (CHEBI:78720) is a organic perchlorate salt (CHEBI:52165) |
| tetramethylrhodamine ethyl ester perchlorate (CHEBI:78720) is a xanthene dye (CHEBI:37929) |
| Synonym | Source |
|---|---|
| TMRE perchlorate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8180460 | Reaxys |
| Citations |
|---|