EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H66N12O12S2 |
| Net Charge | 0 |
| Average Mass | 1007.207 |
| Monoisotopic Mass | 1006.43646 |
| SMILES | [H][C@@]1([C@@H](C)CC)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O |
| InChI | InChI=1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 |
| InChIKey | XNOPRXBHLZRZKH-DSZYJQQASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxytocin (CHEBI:7872) has role oxytocic (CHEBI:36063) |
| oxytocin (CHEBI:7872) has role vasodilator agent (CHEBI:35620) |
| oxytocin (CHEBI:7872) is a heterodetic cyclic peptide (CHEBI:24533) |
| oxytocin (CHEBI:7872) is a peptide hormone (CHEBI:25905) |
| Incoming Relation(s) |
| demoxytocin (CHEBI:135900) has functional parent oxytocin (CHEBI:7872) |
| IUPAC Name |
|---|
| 1-({(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-(4-hydroxybenzyl)-13-[(1S)-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-L-prolyl-L-leucylglycinamide |
| INNs | Source |
|---|---|
| oxitocina | ChemIDplus |
| oxytocin | ChemIDplus |
| oxytocine | ChemIDplus |
| oxytocinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1-Hemicystine)oxytocin | ChemIDplus |
| 3-Isoleucine-8-leucine vasopressin | ChemIDplus |
| Endopituitrina | ChemIDplus |
| L-Cysteinyl-L-tyrosyl-L-isoleucyl-L-glutaminyl-L-asparaginyl-L-cysteinyl-L-prolyl-L-leucylglycinamide cyclic(1-6)-disulfide | ChemIDplus |
| Ocytocin | KEGG COMPOUND |
| OT | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Orasthin | ChemIDplus |
| Pitocin | DrugBank |
| Piton S | ChemIDplus |
| Syntocinon | ChemIDplus |
| Syntocinon | DrugBank |
| Citations |
|---|