EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C30H45NO21)n.H2O |
| Net Charge | 0 |
| Average Mass | 773.691 |
| Monoisotopic Mass | 773.25897 |
| SMILES | [H]O[C@H]1[C@H](O[C@H]2[C@@H](O[C@@H]3[C@H](O)[C@@H](OC(C)=O)[C@H](O[C@H]4[C@@H](O)[C@@H](CO)O[C@@H](O)[C@@H]4NC(C)=O)O[C@@H]3C(=O)O)O[C@@H](C)[C@H](O)[C@H]2O)O[C@@H](C)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H47NO22/c1-7-14(36)17(39)23(52-28-19(41)21(47-10(4)34)15(37)8(2)45-28)29(46-7)51-22-18(40)24(48-11(5)35)30(53-25(22)26(42)43)50-20-13(31-9(3)33)27(44)49-12(6-32)16(20)38/h7-8,12-25,27-30,32,36-41,44H,6H2,1-5H3,(H,31,33)(H,42,43)/t7-,8-,12+,13+,14-,15-,16-,17+,18-,19+,20+,21+,22+,23+,24+,25-,27+,28-,29+,30+/m0/s1 |
| InChIKey | RJCKAPFLVMTBQJ-LNUQUYENSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S. flexneri serotype 6 O-polysaccharide (O factor 9-positive) (CHEBI:78719) has role antigen (CHEBI:59132) |
| S. flexneri serotype 6 O-polysaccharide (O factor 9-positive) (CHEBI:78719) is a polysaccharide derivative (CHEBI:65212) |
| Synonyms | Source |
|---|---|
| [2)-α-L-RhaIII3/4Ac-(1→2)-α-L-RhaII-(1→4)-β-D-GalA-(1→3)-β-D-GalNAc-(1→]n | ChEBI |
| [2)-α-L-RhaIIIp3/4Ac-(1→2)-α-L-RhaIIp-(1→4)-β-D-GalpA-(1→3)-β-D-GalpNAc-(1→]n | ChEBI |
| Citations |
|---|