EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)C(=O)C[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-2(4(9)6(12)13)1-3(8)5(10)11/h2,4,7,9H,1H2,(H,10,11)(H,12,13)/t2-,4+/m1/s1 |
| InChIKey | QUURPCHWPQNNGL-FONMRSAGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deoxy-D-threo-hex-2-ulosaric acid (CHEBI:78709) is a hexaric acid derivative (CHEBI:63438) |
| 3-deoxy-D-threo-hex-2-ulosaric acid (CHEBI:78709) is conjugate acid of 3-deoxy-D-threo-hex-2-ulosarate(2−) (CHEBI:78267) |
| Incoming Relation(s) |
| 3-deoxy-D-threo-hex-2-ulosarate(2−) (CHEBI:78267) is conjugate base of 3-deoxy-D-threo-hex-2-ulosaric acid (CHEBI:78709) |
| IUPAC Name |
|---|
| 3-deoxy-D-threo-hex-2-ulosaric acid |
| Synonyms | Source |
|---|---|
| (2S,3R)-2,3-dihydroxy-5-oxohexanedioic acid | ChEBI |
| 2-keto-D-threo-4,5-dihydroxyadipic acid | ChEBI |