EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O2 |
| Net Charge | 0 |
| Average Mass | 308.506 |
| Monoisotopic Mass | 308.27153 |
| SMILES | CCCCCCCC/C=C\C/C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13H,2-8,11,14-19H2,1H3,(H,21,22)/b10-9-,13-12- |
| InChIKey | XUJWOMMOEOHPFP-UTJQPWESSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8Z,11Z)-icosadienoic acid (CHEBI:78706) is a icosadienoic acid (CHEBI:72850) |
| (8Z,11Z)-icosadienoic acid (CHEBI:78706) is conjugate acid of (8Z,11Z)-icosadienoate(1−) (CHEBI:78707) |
| Incoming Relation(s) |
| (8Z,11Z)-icosadienoate(1−) (CHEBI:78707) is conjugate base of (8Z,11Z)-icosadienoic acid (CHEBI:78706) |
| IUPAC Name |
|---|
| (8Z,11Z)-icosa-8,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 20:2(ω-9), all-cis | SUBMITTER |
| (8Z,11Z)-eicosa-8,11-dienoic acid | SUBMITTER |
| (8Z,11Z)-eicosadienoic acid | ChEBI |
| 8Z,11Z-eicosadienoic acid | LIPID MAPS |
| C20:2n-9,12 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030377 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15479753 | Reaxys |
| Citations |
|---|