EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N6O |
| Net Charge | 0 |
| Average Mass | 166.144 |
| Monoisotopic Mass | 166.06031 |
| SMILES | Nc1nc(NO)c2ncnc2n1 |
| InChI | InChI=1S/C5H6N6O/c6-5-9-3-2(7-1-8-3)4(10-5)11-12/h1,12H,(H4,6,7,8,9,10,11) |
| InChIKey | UJUHACUYECLPGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) has functional parent adenine (CHEBI:16708) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) has role mutagen (CHEBI:25435) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) has role teratogenic agent (CHEBI:50905) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) is a 2,6-diaminopurines (CHEBI:38001) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) is a hydroxylamines (CHEBI:24709) |
| 2-amino-6-hydroxyaminopurine (CHEBI:78685) is a nucleobase analogue (CHEBI:67142) |
| IUPAC Name |
|---|
| N6-hydroxy-3H-purine-2,6-diamine |
| Synonyms | Source |
|---|---|
| 2-amino-N6-hydroxyadenine | ChEBI |
| 2-Amino-N6-hydroxyadenine | ChemIDplus |
| 2-Amino-N(6)-hydroxyadenine | ChemIDplus |
| guanine oxime | MetaCyc |
| UniProt Name | Source |
|---|---|
| 2-amino-N6-hydroxyadenine | UniProt |
| Citations |
|---|