EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O3 |
| Net Charge | 0 |
| Average Mass | 344.455 |
| Monoisotopic Mass | 344.20999 |
| SMILES | CN1CCCN=C1COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O3/c1-22-14-8-13-21-18(22)15-25-19(23)20(24,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2,4-5,9-10,17,24H,3,6-8,11-15H2,1H3 |
| InChIKey | DUDKAZCAISNGQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxyphencyclimine (CHEBI:7868) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| daricon | DrugCentral |
| Oxyphencyclimine | KEGG COMPOUND |
| oxyphencyclimine HCl | DrugCentral |
| oxyphencyclimine hydrochloride | DrugCentral |
| oxyphencyclimine monohydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2026 | DrugCentral |
| C07851 | KEGG COMPOUND |
| D08325 | KEGG DRUG |
| HMDB0014527 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:125-53-1 | KEGG COMPOUND |