EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10N2O2 |
| Net Charge | 0 |
| Average Mass | 250.257 |
| Monoisotopic Mass | 250.07423 |
| SMILES | O=C1C(Nc2ccccc2)=CC(=O)c2ncccc21 |
| InChI | InChI=1S/C15H10N2O2/c18-13-9-12(17-10-5-2-1-3-6-10)15(19)11-7-4-8-16-14(11)13/h1-9,17H |
| InChIKey | GXIJYWUWLNHKNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 4.6.1.2 (guanylate cyclase) inhibitor An EC 4.6.* (P‒O lyase) inhibitor that interferes with the action of enzyme guanylate cyclase (EC 4.6.1.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) has role antineoplastic agent (CHEBI:35610) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) has role EC 4.6.1.2 (guanylate cyclase) inhibitor (CHEBI:78678) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) is a p-quinones (CHEBI:25830) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) is a aminoquinoline (CHEBI:36709) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) is a aromatic amine (CHEBI:33860) |
| 6-anilino-5,8-quinolinedione (CHEBI:78677) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 6-anilinoquinoline-5,8-dione |
| Synonyms | Source |
|---|---|
| 6-(Phenylamino)-5,8-quinolinedione | ChemIDplus |
| LY 83583 | ChemIDplus |
| LY-83583 | ChemIDplus |
| LY83583 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3393 | LINCS |
| HMDB0247642 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:207004 | Reaxys |
| CAS:91300-60-6 | ChemIDplus |
| Citations |
|---|