EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO4.HCl |
| Net Charge | 0 |
| Average Mass | 337.803 |
| Monoisotopic Mass | 337.10809 |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5.Cl |
| InChI | InChI=1S/C17H19NO4.ClH/c1-18-7-6-16-13-9-2-3-10(19)14(13)22-15(16)11(20)4-5-17(16,21)12(18)8-9;/h2-3,12,15,19,21H,4-8H2,1H3;1H/t12-,15+,16+,17-;/m1./s1 |
| InChIKey | BCGJBQBWUGVESK-KCTCKCTRSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxymorphone hydrochloride (CHEBI:7866) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| Oxymorphone hydrochloride | KEGG COMPOUND |
| Numorphan | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00844 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:357-07-3 | KEGG COMPOUND |