EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O.HCl |
| Net Charge | 0 |
| Average Mass | 296.842 |
| Monoisotopic Mass | 296.16554 |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CC1=NCCN1.Cl |
| InChI | InChI=1S/C16H24N2O.ClH/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14;/h8,19H,6-7,9H2,1-5H3,(H,17,18);1H |
| InChIKey | BEEDODBODQVSIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. vasoconstrictor agent Drug used to cause constriction of the blood vessels. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxymetazoline hydrochloride (CHEBI:7863) has part oxymetazoline(1+) (CHEBI:77716) |
| oxymetazoline hydrochloride (CHEBI:7863) has role nasal decongestant (CHEBI:77715) |
| oxymetazoline hydrochloride (CHEBI:7863) has role sympathomimetic agent (CHEBI:35524) |
| oxymetazoline hydrochloride (CHEBI:7863) has role vasoconstrictor agent (CHEBI:50514) |
| oxymetazoline hydrochloride (CHEBI:7863) has role α-adrenergic agonist (CHEBI:35569) |
| oxymetazoline hydrochloride (CHEBI:7863) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 2-(4-tert-butyl-3-hydroxy-2,6-dimethylbenzyl)-4,5-dihydro-1H-imidazol-1-ium chloride |
| 6-tert-butyl-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,4-dimethylphenol hydrochloride |
| Synonyms | Source |
|---|---|
| 2,6-dimethyl-2-(4-tertiarybutyl-3-hydroxyphenyl)methylimidazoline hydrochloride | ChemIDplus |
| 2-(4-t-butyl-2,6-dimethyl-3-hydroxybenzyl)-2-imidazolinium chloride | ChemIDplus |
| oxymetazoline HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ocuclear | KEGG DRUG |
| Sinex | ChemIDplus |
| Afrazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01022 | KEGG DRUG |
| DB00935 | DrugBank |
| HMDB0015070 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5462995 | Reaxys |
| CAS:2315-02-8 | ChemIDplus |
| Citations |
|---|