EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O5 |
| Net Charge | -2 |
| Average Mass | 170.120 |
| Monoisotopic Mass | 170.02262 |
| SMILES | O=C([O-])C/C=C/C=C(\O)C(=O)[O-] |
| InChI | InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-3,8H,4H2,(H,9,10)(H,11,12)/p-2/b2-1+,5-3- |
| InChIKey | ZBCBETMBSDTINL-WFTYEQLWSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhepta-2,4-dienedioate (CHEBI:78626) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-hydroxyhepta-2,4-dienedioate (CHEBI:78626) is conjugate base of 2-hydroxyhepta-2,4-dienedioic acid (CHEBI:1162) |
| 2-hydroxyhepta-2,4-dienedioate (CHEBI:78626) is tautomer of 2-oxohept-4-ene-1,7-dioate (CHEBI:78627) |
| Incoming Relation(s) |
| 2-hydroxyhepta-2,4-dienedioic acid (CHEBI:1162) is conjugate acid of 2-hydroxyhepta-2,4-dienedioate (CHEBI:78626) |
| 2-oxohept-4-ene-1,7-dioate (CHEBI:78627) is tautomer of 2-hydroxyhepta-2,4-dienedioate (CHEBI:78626) |
| IUPAC Name |
|---|
| (2Z,4E)-2-hydroxyhepta-2,4-dienedioate |
| UniProt Name | Source |
|---|---|
| 2-hydroxyhepta-2,4-dienedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-787 | MetaCyc |