EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13F6N3O2S |
| Net Charge | 0 |
| Average Mass | 473.398 |
| Monoisotopic Mass | 473.06327 |
| SMILES | C[C@](C#N)(COc1cc(C#N)ccc1C(F)(F)F)NC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13F6N3O2S/c1-18(10-28,11-31-16-8-12(9-27)2-7-15(16)19(21,22)23)29-17(30)13-3-5-14(6-4-13)32-20(24,25)26/h2-8H,11H2,1H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | WTERNLDOAPYGJD-SFHVURJKSA-N |
| Roles Classification |
|---|
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monepantel (CHEBI:78621) has role anthelminthic drug (CHEBI:35443) |
| monepantel (CHEBI:78621) has role nematicide (CHEBI:25491) |
| monepantel (CHEBI:78621) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| monepantel (CHEBI:78621) is a aromatic ether (CHEBI:35618) |
| monepantel (CHEBI:78621) is a aryl sulfide (CHEBI:35683) |
| monepantel (CHEBI:78621) is a nitrile (CHEBI:18379) |
| monepantel (CHEBI:78621) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-{(2S)-2-cyano-1-[5-cyano-2-(trifluoromethyl)phenoxy]propan-2-yl}-4-[(trifluoromethyl)sulfanyl]benzamide |
| INNs | Source |
|---|---|
| monepantel | WHO MedNet |
| monepantel | WHO MedNet |
| monépantel | WHO MedNet |
| monepantelum | WHO MedNet |
| Brand Name | Source |
|---|---|
| ZOLVIX | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12337563 | Reaxys |
| CAS:887148-69-8 | ChemIDplus |
| Citations |
|---|