EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O |
| Net Charge | 0 |
| Average Mass | 260.381 |
| Monoisotopic Mass | 260.18886 |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CC1=NCCN1 |
| InChI | InChI=1S/C16H24N2O/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14/h8,19H,6-7,9H2,1-5H3,(H,17,18) |
| InChIKey | WYWIFABBXFUGLM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxymetazoline (CHEBI:7862) has role nasal decongestant (CHEBI:77715) |
| oxymetazoline (CHEBI:7862) has role sympathomimetic agent (CHEBI:35524) |
| oxymetazoline (CHEBI:7862) has role vasoconstrictor agent (CHEBI:50514) |
| oxymetazoline (CHEBI:7862) has role α-adrenergic agonist (CHEBI:35569) |
| oxymetazoline (CHEBI:7862) is a carboxamidine (CHEBI:35359) |
| oxymetazoline (CHEBI:7862) is a imidazolines (CHEBI:53095) |
| oxymetazoline (CHEBI:7862) is a phenols (CHEBI:33853) |
| oxymetazoline (CHEBI:7862) is conjugate base of oxymetazoline(1+) (CHEBI:77716) |
| Incoming Relation(s) |
| oxymetazoline(1+) (CHEBI:77716) is conjugate acid of oxymetazoline (CHEBI:7862) |
| IUPAC Name |
|---|
| 6-tert-butyl-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,4-dimethylphenol |
| INNs | Source |
|---|---|
| oxymetazolina | WHO MedNet |
| oxymetazoline | WHO MedNet |
| oxymétazoline | WHO MedNet |
| oxymetazolinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(4-tert-butyl-2,6-dimethyl-3-hydroxybenzyl)-2-imidazoline | NIST Chemistry WebBook |
| 3-[(4,5-dihydro-1H-imidazol-2-yl)methyl]-6-(1,1-dimethylethyl)-2,4-dimethylphenol | NIST Chemistry WebBook |
| 6-tert-butyl-3-(2-imidazolin-2-ylmethyl)-2,4-dimethylphenol | NIST Chemistry WebBook |
| 6-t-butyl-3-(2-imidazolin-2-ylmethyl)-2,4-dimethylphenol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2032 | DrugCentral |
| C07363 | KEGG COMPOUND |
| D08322 | KEGG DRUG |
| DB00935 | DrugBank |
| DE1117588 | Patent |
| HMDB0015070 | HMDB |
| LSM-2353 | LINCS |
| Oxymetazoline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:886303 | Reaxys |
| CAS:1491-59-4 | KEGG COMPOUND |
| CAS:1491-59-4 | NIST Chemistry WebBook |
| Citations |
|---|