EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H45NO9 |
| Net Charge | 0 |
| Average Mass | 503.633 |
| Monoisotopic Mass | 503.30943 |
| SMILES | C=C1C[C@](OC)([C@H](O)C(=O)N[C@@H](OC)[C@@H]2C[C@@H](O)C(C)(C)[C@@H](C[C@@H](COC)OC)O2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H45NO9/c1-14-12-25(33-9,35-16(3)15(14)2)21(28)22(29)26-23(32-8)18-11-19(27)24(4,5)20(34-18)10-17(31-7)13-30-6/h15-21,23,27-28H,1,10-13H2,2-9H3,(H,26,29)/t15-,16-,17+,18+,19-,20-,21-,23+,25-/m1/s1 |
| InChIKey | ZNEZZONMADKYTB-VRCUBXEUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). vesicant Any compound that causes severe skin, eye and mucosal pain and irritation. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pederin (CHEBI:78591) has role antimitotic (CHEBI:64911) |
| pederin (CHEBI:78591) has role antineoplastic agent (CHEBI:35610) |
| pederin (CHEBI:78591) has role bacterial metabolite (CHEBI:76969) |
| pederin (CHEBI:78591) has role vesicant (CHEBI:78592) |
| pederin (CHEBI:78591) is a cyclic ketal (CHEBI:59779) |
| pederin (CHEBI:78591) is a diol (CHEBI:23824) |
| pederin (CHEBI:78591) is a oxanes (CHEBI:46942) |
| pederin (CHEBI:78591) is a polyketide (CHEBI:26188) |
| pederin (CHEBI:78591) is a secondary alcohol (CHEBI:35681) |
| pederin (CHEBI:78591) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2S)-N-[(S)-{(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-hydroxy-5,5-dimethyltetrahydro-2H-pyran-2-yl}(methoxy)methyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylenetetrahydro-2H-pyran-2-yl]acetamide |
| Synonyms | Source |
|---|---|
| (+)-pederine | ChEBI |
| (+)-pederin | ChEBI |
| pederine | ChemIDplus |
| paederine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3598743 | Reaxys |
| CAS:27973-72-4 | ChemIDplus |
| CAS:27973-72-4 | KEGG COMPOUND |
| Citations |
|---|