EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO4.HCl |
| Net Charge | 0 |
| Average Mass | 351.830 |
| Monoisotopic Mass | 351.12374 |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314.Cl |
| InChI | InChI=1S/C18H21NO4.ClH/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10;/h3-4,13,16,21H,5-9H2,1-2H3;1H/t13-,16+,17+,18-;/m1./s1 |
| InChIKey | MUZQPDBAOYKNLO-RKXJKUSZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxycodone hydrochloride (CHEBI:7859) has part oxycodone(1+) (CHEBI:134686) |
| oxycodone hydrochloride (CHEBI:7859) has role antitussive (CHEBI:51177) |
| oxycodone hydrochloride (CHEBI:7859) has role opioid analgesic (CHEBI:35482) |
| oxycodone hydrochloride (CHEBI:7859) has role μ-opioid receptor agonist (CHEBI:55322) |
| oxycodone hydrochloride (CHEBI:7859) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Troxyca ER (CHEBI:134679) has part oxycodone hydrochloride (CHEBI:7859) |
| IUPAC Names |
|---|
| 14-hydroxy-3-methoxy-17-methyl-4,5α-epoxymorphinan-6-one hydrochloride |
| (5α,17S)-14-hydroxy-3-methoxy-17-methyl-6-oxo-4,5-epoxymorphinan-17-ium chloride |
| Synonyms | Source |
|---|---|
| 14-Hydroxydihydrocodeinone hydrochloride | ChemIDplus |
| 4,5α-Epoxy-14-hydroxy-3-methoxy-17-methylmorphinan-6-one hydrochloride | ChemIDplus |
| Dihydrone hydrochloride | ChemIDplus |
| Dihydrooxycodeinone hydrochloride | ChemIDplus |
| Dihydroxycodeinone hydrochloride | ChemIDplus |
| Oxycodone HCl | ChemIDplus |
| Citations |
|---|