EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C22H31NO3.Cl |
| Net Charge | 0 |
| Average Mass | 393.955 |
| Monoisotopic Mass | 393.20707 |
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1.[Cl-].[H+] |
| InChI | InChI=1S/C22H31NO3.ClH/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20;/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3;1H |
| InChIKey | SWIJYDAEGSIQPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybutynin chloride (CHEBI:7857) has part oxybutynin (CHEBI:7856) |
| oxybutynin chloride (CHEBI:7857) has role antineoplastic agent (CHEBI:35610) |
| oxybutynin chloride (CHEBI:7857) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-(diethylamino)but-2-yn-1-yl cyclohexyl(hydroxy)phenylacetate hydrochloride |
| Synonyms | Source |
|---|---|
| 4-(Diethylamino)-2-butynyl alpha-phenylcyclohexaneglycolate hydrochloride | ChemIDplus |
| 4-Diethylamino-2-butynyl phenyl(cyclohexyl)glycolate hydrochloride | ChemIDplus |
| 5058 | ChEMBL |
| MJ 4309-1 | ChEMBL |
| MJ-4309-1 | ChEMBL |
| NSC-759108 | ChEMBL |
| Brand Names | Source |
|---|---|
| Ditropan xl | ChEMBL |
| Gelnique | ChEMBL |
| Citations |
|---|