EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1ccc(-c2oc3cc(OC)c(O)c(O)c3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C18H16O8/c1-23-10-5-4-8(6-9(10)19)17-18(25-3)16(22)13-11(26-17)7-12(24-2)14(20)15(13)21/h4-7,19-21H,1-3H3 |
| InChIKey | UQBUUCDVKDSHCE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyayanin B (CHEBI:7855) has functional parent flavone (CHEBI:42491) |
| oxyayanin B (CHEBI:7855) has role plant metabolite (CHEBI:76924) |
| oxyayanin B (CHEBI:7855) is a trihydroxyflavone (CHEBI:27116) |
| oxyayanin B (CHEBI:7855) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 3',5,6-trihydroxy-3,4',7-trimethoxyflavone | ChEBI |