EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30FN3O2 |
| Net Charge | 0 |
| Average Mass | 375.488 |
| Monoisotopic Mass | 375.23221 |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-18-8-6-17(7-9-18)19(26)5-4-12-24-15-10-21(11-16-24,20(23)27)25-13-2-1-3-14-25/h6-9H,1-5,10-16H2,(H2,23,27) |
| InChIKey | AXKPFOAXAHJUAG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipamperone (CHEBI:78549) has role dopaminergic antagonist (CHEBI:48561) |
| pipamperone (CHEBI:78549) has role first generation antipsychotic (CHEBI:65190) |
| pipamperone (CHEBI:78549) has role serotonergic antagonist (CHEBI:48279) |
| pipamperone (CHEBI:78549) is a aromatic ketone (CHEBI:76224) |
| pipamperone (CHEBI:78549) is a bipiperidines (CHEBI:48576) |
| pipamperone (CHEBI:78549) is a monocarboxylic acid amide (CHEBI:29347) |
| pipamperone (CHEBI:78549) is a organofluorine compound (CHEBI:37143) |
| pipamperone (CHEBI:78549) is a tertiary amino compound (CHEBI:50996) |
| pipamperone (CHEBI:78549) is conjugate base of pipamperone(2+) (CHEBI:78943) |
| Incoming Relation(s) |
| pipamperone(2+) (CHEBI:78943) is conjugate acid of pipamperone (CHEBI:78549) |
| IUPAC Name |
|---|
| 1'-[4-(4-fluorophenyl)-4-oxobutyl]-1,4'-bipiperidine-4'-carboxamide |
| INNs | Source |
|---|---|
| pipamperona | WHO MedNet |
| pipamperone | WHO MedNet |
| pipampérone | WHO MedNet |
| pipamperonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1'-(3-(p-fluorobenzoyl)propyl)-(1,4'-bipiperidine)-4'-carboxamide | ChemIDplus |
| p-fluoro-γ-(4-piperidino-4-carbamoylpiperidino)butyrophenone | ChemIDplus |
| floropipamide | ChemIDplus |
| R 3345 | ChemIDplus |
| R-3345 | ChEBI |
| Citations |
|---|