EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18F5NO4 |
| Net Charge | 0 |
| Average Mass | 419.346 |
| Monoisotopic Mass | 419.11560 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H18F5NO4/c1-5-28-18(26)9-7(3)25-8(4)10(19(27)29-6-2)11(9)12-13(20)15(22)17(24)16(23)14(12)21/h11,25H,5-6H2,1-4H3 |
| InChIKey | QABNLWXKUCMDBP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nemadipine-A (CHEBI:78546) has role calcium channel blocker (CHEBI:38215) |
| nemadipine-A (CHEBI:78546) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nemadipine-A (CHEBI:78546) is a diester (CHEBI:51307) |
| nemadipine-A (CHEBI:78546) is a dihydropyridine (CHEBI:50075) |
| nemadipine-A (CHEBI:78546) is a ethyl ester (CHEBI:23990) |
| nemadipine-A (CHEBI:78546) is a pentafluorobenzenes (CHEBI:85065) |
| IUPAC Name |
|---|
| diethyl 2,6-dimethyl-4-(pentafluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Synonym | Source |
|---|---|
| nemadipine A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:458028 | Reaxys |
| Citations |
|---|