EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N5 |
| Net Charge | 0 |
| Average Mass | 301.353 |
| Monoisotopic Mass | 301.13275 |
| SMILES | Cc1cc(Nc2nc(-c3ccccc3)nc3ccccc23)nn1 |
| InChI | InChI=1S/C18H15N5/c1-12-11-16(23-22-12)20-18-14-9-5-6-10-15(14)19-17(21-18)13-7-3-2-4-8-13/h2-11H,1H3,(H2,19,20,21,22,23) |
| InChIKey | JYCUVOXSZBECAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK3-XIII (CHEBI:78544) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| GSK3-XIII (CHEBI:78544) is a aromatic amine (CHEBI:33860) |
| GSK3-XIII (CHEBI:78544) is a pyrazoles (CHEBI:26410) |
| GSK3-XIII (CHEBI:78544) is a quinazolines (CHEBI:38530) |
| GSK3-XIII (CHEBI:78544) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(5-methyl-1H-pyrazol-3-yl)-2-phenylquinazolin-4-amine |
| Synonym | Source |
|---|---|
| GSK-3 inhibitor XIII | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9930672 | Reaxys |
| Citations |
|---|