EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O7S |
| Net Charge | 0 |
| Average Mass | 460.508 |
| Monoisotopic Mass | 460.13042 |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)N2C(=O)c3cccc(NC(C)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C22H24N2O7S/c1-5-31-19-11-14(9-10-18(19)30-3)17(12-32(4,28)29)24-21(26)15-7-6-8-16(23-13(2)25)20(15)22(24)27/h6-11,17H,5,12H2,1-4H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | IMOZEMNVLZVGJZ-QGZVFWFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apremilast (CHEBI:78540) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| apremilast (CHEBI:78540) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| apremilast (CHEBI:78540) is a N-acetylarylamine (CHEBI:13790) |
| apremilast (CHEBI:78540) is a aromatic ether (CHEBI:35618) |
| apremilast (CHEBI:78540) is a phthalimides (CHEBI:82851) |
| apremilast (CHEBI:78540) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-{2-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl]-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl}acetamide |
| INNs | Source |
|---|---|
| apremilast | WHO MedNet |
| apremilast | ChemIDplus |
| aprémilast | WHO MedNet |
| apremilastum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CC 10004 | ChemIDplus |
| CC-10004 | ChemIDplus |
| CC10004 | ChemIDplus |
| Brand Name | Source |
|---|---|
| OTEZLA | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4829 | DrugCentral |
| Apremilast | Wikipedia |
| D08860 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12446985 | Reaxys |
| CAS:608141-41-9 | ChemIDplus |
| CAS:608141-41-9 | KEGG DRUG |
| Citations |
|---|