EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(OC)cc3O)oc2c1 |
| InChI | InChI=1S/C18H16O8/c1-23-8-4-12(21)15-14(5-8)26-17(18(25-3)16(15)22)9-6-11(20)13(24-2)7-10(9)19/h4-7,19-21H,1-3H3 |
| InChIKey | KGJTXYKKHKRNIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyayanin A (CHEBI:7854) has functional parent flavone (CHEBI:42491) |
| oxyayanin A (CHEBI:7854) has role plant metabolite (CHEBI:76924) |
| oxyayanin A (CHEBI:7854) is a trihydroxyflavone (CHEBI:27116) |
| oxyayanin A (CHEBI:7854) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(2,5-dihydroxy-4-methoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,2',5'-trihydroxy-3,7,4'-trimethoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001079 | KNApSAcK |
| C10115 | KEGG COMPOUND |
| LMPK12112516 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:549-17-7 | KEGG COMPOUND |
| Citations |
|---|