EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO4S2 |
| Net Charge | 0 |
| Average Mass | 429.563 |
| Monoisotopic Mass | 429.10685 |
| SMILES | C[C@H](CSC(=O)c1ccccc1)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H23NO4S2/c1-15(14-28-22(27)16-8-4-2-5-9-16)20(24)23-13-18(12-19(23)21(25)26)29-17-10-6-3-7-11-17/h2-11,15,18-19H,12-14H2,1H3,(H,25,26)/t15-,18+,19+/m1/s1 |
| InChIKey | IAIDUHCBNLFXEF-MNEFBYGVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. vasodilator agent A drug used to cause dilation of the blood vessels. anticonvulsant A drug used to prevent seizures or reduce their severity. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zofenopril (CHEBI:78539) has role anticonvulsant (CHEBI:35623) |
| zofenopril (CHEBI:78539) has role apoptosis inhibitor (CHEBI:68494) |
| zofenopril (CHEBI:78539) has role cardioprotective agent (CHEBI:77307) |
| zofenopril (CHEBI:78539) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| zofenopril (CHEBI:78539) has role prodrug (CHEBI:50266) |
| zofenopril (CHEBI:78539) has role vasodilator agent (CHEBI:35620) |
| zofenopril (CHEBI:78539) is a N-acyl-L-amino acid (CHEBI:21644) |
| zofenopril (CHEBI:78539) is a L-proline derivative (CHEBI:84186) |
| zofenopril (CHEBI:78539) is a aryl sulfide (CHEBI:35683) |
| zofenopril (CHEBI:78539) is a thioester (CHEBI:51277) |
| zofenopril (CHEBI:78539) is conjugate acid of zofenopril(1−) (CHEBI:82601) |
| Incoming Relation(s) |
| zofenopril(1−) (CHEBI:82601) is conjugate base of zofenopril (CHEBI:78539) |
| IUPAC Name |
|---|
| (4S)-1-[(2S)-3-(benzoylsulfanyl)-2-methylpropanoyl]-4-(phenylsulfanyl)-L-proline |
| INNs | Source |
|---|---|
| zofenopril | KEGG DRUG |
| zofenoprilum | ChemIDplus |
| zofenopril | WHO MedNet |
| zofénopril | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| D08688 | KEGG DRUG |
| Zofenopril | Wikipedia |
| 2866 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6443047 | Reaxys |
| CAS:81872-10-8 | KEGG DRUG |
| CAS:81872-10-8 | ChemIDplus |
| Citations |
|---|