EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 308.120 |
| Monoisotopic Mass | 306.98030 |
| SMILES | O=C(O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C14H7Cl2NO3/c15-9-3-8(4-10(16)6-9)13-17-11-2-1-7(14(18)19)5-12(11)20-13/h1-6H,(H,18,19) |
| InChIKey | TXEIIPDJKFWEEC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafamidis (CHEBI:78538) has role central nervous system drug (CHEBI:35470) |
| tafamidis (CHEBI:78538) is a 1,3-benzoxazoles (CHEBI:51548) |
| tafamidis (CHEBI:78538) is a dichlorobenzene (CHEBI:23697) |
| tafamidis (CHEBI:78538) is a monocarboxylic acid (CHEBI:25384) |
| tafamidis (CHEBI:78538) is conjugate acid of tafamidis(1−) (CHEBI:79344) |
| Incoming Relation(s) |
| tafamidis(1−) (CHEBI:79344) is conjugate base of tafamidis (CHEBI:78538) |
| IUPAC Name |
|---|
| 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid |
| INNs | Source |
|---|---|
| tafamidis | WHO MedNet |
| tafamidis | WHO MedNet |
| tafamidis | KEGG DRUG |
| tafamidisum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(3,5-dichlorophenyl)benzoxazole-6-carboxylic acid | ChemIDplus |
| Fx-1006 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3MI | PDBeChem |
| 4192 | DrugCentral |
| D09673 | KEGG DRUG |
| Tafamidis | Wikipedia |
| WO2011131661 | Patent |
| WO2013060668 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9496624 | Reaxys |
| CAS:594839-88-0 | ChemIDplus |
| CAS:594839-88-0 | KEGG DRUG |
| Citations |
|---|