EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H49N3O2 |
| Net Charge | 0 |
| Average Mass | 483.741 |
| Monoisotopic Mass | 483.38248 |
| SMILES | [H][C@@]1(C[C@@]2([H])C[C@H](C)C[C@@]3([H])N(C(C)=O)CCC[C@@]23[H])CC[C@@]2(O)C(=N1)C[C@]1([H])C[C@@H](C)C[C@@H]3N(C)C[C@H]2C[C@@]31[H] |
| InChI | InChI=1S/C30H49N3O2/c1-18-11-22-15-29-30(35,23-16-26(22)27(12-18)32(4)17-23)8-7-24(31-29)14-21-10-19(2)13-28-25(21)6-5-9-33(28)20(3)34/h18-19,21-28,35H,5-17H2,1-4H3/t18-,19+,21-,22+,23-,24+,25+,26-,27+,28-,30+/m1/s1 |
| InChIKey | QRIZONDFXOOWTA-MREYPERPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxolucidine B (CHEBI:7849) has functional parent lucidine B (CHEBI:6556) |
| oxolucidine B (CHEBI:7849) is a decahydroquinoline alkaloid (CHEBI:47009) |
| oxolucidine B (CHEBI:7849) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| oxolucidine B (CHEBI:7849) is a tertiary alcohol (CHEBI:26878) |
| oxolucidine B (CHEBI:7849) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (1R,2S,5S,9S,11R,13S,17R)-5-{[(4aS,5R,7S,8aR)-1-acetyl-7-methyldecahydroquinolin-5-yl]methyl}-11,14-dimethyl-6,14-diazatetracyclo[7.6.2.02,7.013,17]heptadec-6-en-2-ol |
| Synonyms | Source |
|---|---|
| (4aS,5R,7S,8aR)-1-acetyl-5-[[(2S,4aS,5R,6aR,7S,9R,10aS)-3,4,4a,5,6,6a,7,8,9,10,10a,11-dodecahydro-4a-hydroxy-9,12-dimethyl-7,5-(iminomethano)-2H-benzo[5,6]cyclohepta[1,2-b]pyridin-2-yl]methyl]decahydro-7-methylquinoline | IUPAC |
| Oxolucidine B | KEGG COMPOUND |
| Serratanine B | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8600822 | Reaxys |
| CAS:71384-25-3 | ChemIDplus |
| CAS:71384-25-3 | KEGG COMPOUND |
| Citations |
|---|